C13H9Br3O4 — CID 63416345
5-methyl-4-[(2,4,6-tribromophenoxy)methyl]furan-2-carboxylic acid (PubChem CID 63416345) has the molecular formula C13H9Br3O4 and a molecular weight of 468.92 g/mol. Its IUPAC name is 5-methyl-4-[(2,4,6-tribromophenoxy)methyl]furan-2-carboxylic acid.
| Compound Name | 5-methyl-4-[(2,4,6-tribromophenoxy)methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 63416345 |
| Molecular Formula | C13H9Br3O4 |
| Molecular Weight | 468.92 g/mol |
| Exact Mass | 465.81 |
| IUPAC Name | 5-methyl-4-[(2,4,6-tribromophenoxy)methyl]furan-2-carboxylic acid |
| SMILES | Cc1oc(C(=O)O)cc1COc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C13H9Br3O4/c1-6-7(2-11(20-6)13(17)18)5-19-12-9(15)3-8(14)4-10(12)16/h2-4H,5H2,1H3,(H,17,18) |
| InChIKey | IDDSWEPGZFVHFT-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.92 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'furan_acid_A(4)', 'substructure': 'N/A'} |
|---|