C13H10Br2O4 — CID 62274306
4-[(2,4-dibromophenoxy)methyl]-5-methylfuran-2-carboxylic acid (PubChem CID 62274306) has the molecular formula C13H10Br2O4 and a molecular weight of 390.03 g/mol. Its IUPAC name is 4-[(2,4-dibromophenoxy)methyl]-5-methylfuran-2-carboxylic acid.
| Compound Name | 4-[(2,4-dibromophenoxy)methyl]-5-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 62274306 |
| Molecular Formula | C13H10Br2O4 |
| Molecular Weight | 390.03 g/mol |
| Exact Mass | 387.89 |
| IUPAC Name | 4-[(2,4-dibromophenoxy)methyl]-5-methylfuran-2-carboxylic acid |
| SMILES | Cc1oc(C(=O)O)cc1COc1ccc(Br)cc1Br |
| InChI | InChI=1S/C13H10Br2O4/c1-7-8(4-12(19-7)13(16)17)6-18-11-3-2-9(14)5-10(11)15/h2-5H,6H2,1H3,(H,16,17) |
| InChIKey | AWQUFCVHPVUFHD-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.03 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'furan_acid_A(4)', 'substructure': 'N/A'} |
|---|