C14H13NO5 — CID 62273259
4-[(4-carbamoylphenoxy)methyl]-5-methylfuran-2-carboxylic acid (PubChem CID 62273259) has the molecular formula C14H13NO5 and a molecular weight of 275.26 g/mol. Its IUPAC name is 4-[(4-carbamoylphenoxy)methyl]-5-methylfuran-2-carboxylic acid.
| Compound Name | 4-[(4-carbamoylphenoxy)methyl]-5-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 62273259 |
| Molecular Formula | C14H13NO5 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 4-[(4-carbamoylphenoxy)methyl]-5-methylfuran-2-carboxylic acid |
| SMILES | Cc1oc(C(=O)O)cc1COc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C14H13NO5/c1-8-10(6-12(20-8)14(17)18)7-19-11-4-2-9(3-5-11)13(15)16/h2-6H,7H2,1H3,(H2,15,16)(H,17,18) |
| InChIKey | RYVKBSYIFSNJOA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'furan_acid_A(4)', 'substructure': 'N/A'} |
|---|