C15H16O5 — CID 62274131
5-methyl-4-(2-phenoxyethoxymethyl)furan-2-carboxylic acid (PubChem CID 62274131) has the molecular formula C15H16O5 and a molecular weight of 276.29 g/mol. Its IUPAC name is 5-methyl-4-(2-phenoxyethoxymethyl)furan-2-carboxylic acid.
| Compound Name | 5-methyl-4-(2-phenoxyethoxymethyl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 62274131 |
| Molecular Formula | C15H16O5 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 5-methyl-4-(2-phenoxyethoxymethyl)furan-2-carboxylic acid |
| SMILES | Cc1oc(C(=O)O)cc1COCCOc1ccccc1 |
| InChI | InChI=1S/C15H16O5/c1-11-12(9-14(20-11)15(16)17)10-18-7-8-19-13-5-3-2-4-6-13/h2-6,9H,7-8,10H2,1H3,(H,16,17) |
| InChIKey | GYWKRRIWFMXPES-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|