C20H18O5 — CID 68919722
4-[(3-methoxy-4-phenylphenoxy)methyl]-5-methylfuran-2-carboxylic acid (PubChem CID 68919722) has the molecular formula C20H18O5 and a molecular weight of 338.36 g/mol. Its IUPAC name is 4-[(3-methoxy-4-phenylphenoxy)methyl]-5-methylfuran-2-carboxylic acid.
| Compound Name | 4-[(3-methoxy-4-phenylphenoxy)methyl]-5-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 68919722 |
| Molecular Formula | C20H18O5 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 4-[(3-methoxy-4-phenylphenoxy)methyl]-5-methylfuran-2-carboxylic acid |
| SMILES | COc1cc(OCc2cc(C(=O)O)oc2C)ccc1-c1ccccc1 |
| InChI | InChI=1S/C20H18O5/c1-13-15(10-19(25-13)20(21)22)12-24-16-8-9-17(18(11-16)23-2)14-6-4-3-5-7-14/h3-11H,12H2,1-2H3,(H,21,22) |
| InChIKey | NVVDASGBXFTFCO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'furan_acid_A(4)', 'substructure': 'N/A'} |
|---|