C22H22O5 — CID 142869564
2-[2-methoxy-4-[[2-methyl-5-(4-methylphenyl)furan-3-yl]methoxy]phenyl]acetic acid (PubChem CID 142869564) has the molecular formula C22H22O5 and a molecular weight of 366.41 g/mol. Its IUPAC name is 2-[2-methoxy-4-[[2-methyl-5-(4-methylphenyl)furan-3-yl]methoxy]phenyl]acetic acid.
| Compound Name | 2-[2-methoxy-4-[[2-methyl-5-(4-methylphenyl)furan-3-yl]methoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 142869564 |
| Molecular Formula | C22H22O5 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 2-[2-methoxy-4-[[2-methyl-5-(4-methylphenyl)furan-3-yl]methoxy]phenyl]acetic acid |
| SMILES | COc1cc(OCc2cc(-c3ccc(C)cc3)oc2C)ccc1CC(=O)O |
| InChI | InChI=1S/C22H22O5/c1-14-4-6-16(7-5-14)21-10-18(15(2)27-21)13-26-19-9-8-17(11-22(23)24)20(12-19)25-3/h4-10,12H,11,13H2,1-3H3,(H,23,24) |
| InChIKey | FDSHJVIIDJLJGY-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |