C20H18O6 — CID 69145077
[4-[[4-[4-(hydroxymethyl)phenyl]phenoxy]methyl]-5-methylfuran-2-yl] hydrogen carbonate (PubChem CID 69145077) has the molecular formula C20H18O6 and a molecular weight of 354.36 g/mol. Its IUPAC name is [4-[[4-[4-(hydroxymethyl)phenyl]phenoxy]methyl]-5-methylfuran-2-yl] hydrogen carbonate.
| Compound Name | [4-[[4-[4-(hydroxymethyl)phenyl]phenoxy]methyl]-5-methylfuran-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 69145077 |
| Molecular Formula | C20H18O6 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | [4-[[4-[4-(hydroxymethyl)phenyl]phenoxy]methyl]-5-methylfuran-2-yl] hydrogen carbonate |
| SMILES | Cc1oc(OC(=O)O)cc1COc1ccc(-c2ccc(CO)cc2)cc1 |
| InChI | InChI=1S/C20H18O6/c1-13-17(10-19(25-13)26-20(22)23)12-24-18-8-6-16(7-9-18)15-4-2-14(11-21)3-5-15/h2-10,21H,11-12H2,1H3,(H,22,23) |
| InChIKey | ZOMWNXBOZGPBIZ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |