C26H23NO5S — CID 58824159
N-[5-methyl-4-[(4-phenylphenoxy)methyl]furan-2-yl]sulfonyl-2-phenylacetamide (PubChem CID 58824159) has the molecular formula C26H23NO5S and a molecular weight of 461.54 g/mol. Its IUPAC name is N-[5-methyl-4-[(4-phenylphenoxy)methyl]furan-2-yl]sulfonyl-2-phenylacetamide.
| Compound Name | N-[5-methyl-4-[(4-phenylphenoxy)methyl]furan-2-yl]sulfonyl-2-phenylacetamide |
|---|---|
| PubChem CID | 58824159 |
| Molecular Formula | C26H23NO5S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | N-[5-methyl-4-[(4-phenylphenoxy)methyl]furan-2-yl]sulfonyl-2-phenylacetamide |
| SMILES | Cc1oc(S(=O)(=O)NC(=O)Cc2ccccc2)cc1COc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H23NO5S/c1-19-23(18-31-24-14-12-22(13-15-24)21-10-6-3-7-11-21)17-26(32-19)33(29,30)27-25(28)16-20-8-4-2-5-9-20/h2-15,17H,16,18H2,1H3,(H,27,28) |
| InChIKey | VEOJDEMUKILBML-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |