C19H13F3O4 — CID 18444588
4-[(4-phenylphenoxy)methyl]-5-(trifluoromethyl)furan-2-carboxylic acid (PubChem CID 18444588) has the molecular formula C19H13F3O4 and a molecular weight of 362.30 g/mol. Its IUPAC name is 4-[(4-phenylphenoxy)methyl]-5-(trifluoromethyl)furan-2-carboxylic acid.
| Compound Name | 4-[(4-phenylphenoxy)methyl]-5-(trifluoromethyl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 18444588 |
| Molecular Formula | C19H13F3O4 |
| Molecular Weight | 362.30 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 4-[(4-phenylphenoxy)methyl]-5-(trifluoromethyl)furan-2-carboxylic acid |
| SMILES | O=C(O)c1cc(COc2ccc(-c3ccccc3)cc2)c(C(F)(F)F)o1 |
| InChI | InChI=1S/C19H13F3O4/c20-19(21,22)17-14(10-16(26-17)18(23)24)11-25-15-8-6-13(7-9-15)12-4-2-1-3-5-12/h1-10H,11H2,(H,23,24) |
| InChIKey | SAGWNXBYZYNMDZ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.30 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |