C20H15F3O4 — CID 18444604
5-methyl-4-[[3-[3-(trifluoromethyl)phenyl]phenoxy]methyl]furan-2-carboxylic acid (PubChem CID 18444604) has the molecular formula C20H15F3O4 and a molecular weight of 376.33 g/mol. Its IUPAC name is 5-methyl-4-[[3-[3-(trifluoromethyl)phenyl]phenoxy]methyl]furan-2-carboxylic acid.
| Compound Name | 5-methyl-4-[[3-[3-(trifluoromethyl)phenyl]phenoxy]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 18444604 |
| Molecular Formula | C20H15F3O4 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 5-methyl-4-[[3-[3-(trifluoromethyl)phenyl]phenoxy]methyl]furan-2-carboxylic acid |
| SMILES | Cc1oc(C(=O)O)cc1COc1cccc(-c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C20H15F3O4/c1-12-15(10-18(27-12)19(24)25)11-26-17-7-3-5-14(9-17)13-4-2-6-16(8-13)20(21,22)23/h2-10H,11H2,1H3,(H,24,25) |
| InChIKey | JLDFSPDWTPDMJI-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'furan_acid_A(4)', 'substructure': 'N/A'} |
|---|