C16H13F3O4 — CID 11723882
2-hydroxy-5-methyl-3-[[3-(trifluoromethyl)phenoxy]methyl]benzoic acid (PubChem CID 11723882) has the molecular formula C16H13F3O4 and a molecular weight of 326.27 g/mol. Its IUPAC name is 2-hydroxy-5-methyl-3-[[3-(trifluoromethyl)phenoxy]methyl]benzoic acid.
| Compound Name | 2-hydroxy-5-methyl-3-[[3-(trifluoromethyl)phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 11723882 |
| Molecular Formula | C16H13F3O4 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 2-hydroxy-5-methyl-3-[[3-(trifluoromethyl)phenoxy]methyl]benzoic acid |
| SMILES | Cc1cc(COc2cccc(C(F)(F)F)c2)c(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C16H13F3O4/c1-9-5-10(14(20)13(6-9)15(21)22)8-23-12-4-2-3-11(7-12)16(17,18)19/h2-7,20H,8H2,1H3,(H,21,22) |
| InChIKey | UTXOAQXWABWEBC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |