C15H12Cl2O4 — CID 10404151
3-[(2,3-dichlorophenoxy)methyl]-2-hydroxy-5-methylbenzoic acid (PubChem CID 10404151) has the molecular formula C15H12Cl2O4 and a molecular weight of 327.16 g/mol. Its IUPAC name is 3-[(2,3-dichlorophenoxy)methyl]-2-hydroxy-5-methylbenzoic acid.
| Compound Name | 3-[(2,3-dichlorophenoxy)methyl]-2-hydroxy-5-methylbenzoic acid |
|---|---|
| PubChem CID | 10404151 |
| Molecular Formula | C15H12Cl2O4 |
| Molecular Weight | 327.16 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | 3-[(2,3-dichlorophenoxy)methyl]-2-hydroxy-5-methylbenzoic acid |
| SMILES | Cc1cc(COc2cccc(Cl)c2Cl)c(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C15H12Cl2O4/c1-8-5-9(14(18)10(6-8)15(19)20)7-21-12-4-2-3-11(16)13(12)17/h2-6,18H,7H2,1H3,(H,19,20) |
| InChIKey | WQIGKPYEHHFFRM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.16 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |