C10H12Cl2O4 — CID 174851678
2-(2,3-dichlorophenoxy)acetic acid;ethanol (PubChem CID 174851678) has the molecular formula C10H12Cl2O4 and a molecular weight of 267.11 g/mol. Its IUPAC name is 2-(2,3-dichlorophenoxy)acetic acid;ethanol.
| Compound Name | 2-(2,3-dichlorophenoxy)acetic acid;ethanol |
|---|---|
| PubChem CID | 174851678 |
| Molecular Formula | C10H12Cl2O4 |
| Molecular Weight | 267.11 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | 2-(2,3-dichlorophenoxy)acetic acid;ethanol |
| SMILES | CCO.O=C(O)COc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C8H6Cl2O3.C2H6O/c9-5-2-1-3-6(8(5)10)13-4-7(11)12;1-2-3/h1-3H,4H2,(H,11,12);3H,2H2,1H3 |
| InChIKey | AJQCTKYNJWLJOB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.11 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |