C13H16Cl2N2O3 — CID 8604340
N-[[(2R)-butan-2-yl]carbamoyl]-2-(2,3-dichlorophenoxy)acetamide (PubChem CID 8604340) has the molecular formula C13H16Cl2N2O3 and a molecular weight of 319.19 g/mol. Its IUPAC name is N-[[(2R)-butan-2-yl]carbamoyl]-2-(2,3-dichlorophenoxy)acetamide.
| Compound Name | N-[[(2R)-butan-2-yl]carbamoyl]-2-(2,3-dichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 8604340 |
| Molecular Formula | C13H16Cl2N2O3 |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | N-[[(2R)-butan-2-yl]carbamoyl]-2-(2,3-dichlorophenoxy)acetamide |
| SMILES | CC[C@@H](C)NC(=O)NC(=O)COc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H16Cl2N2O3/c1-3-8(2)16-13(19)17-11(18)7-20-10-6-4-5-9(14)12(10)15/h4-6,8H,3,7H2,1-2H3,(H2,16,17,18,19)/t8-/m1/s1 |
| InChIKey | KRDBVGFCPCMJQG-MRVPVSSYSA-N |
| XLogP | 3.00 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |