C12H15Cl2NO3 — CID 112547485
4-(2,3-dichlorophenoxy)-3-(dimethylamino)butanoic acid (PubChem CID 112547485) has the molecular formula C12H15Cl2NO3 and a molecular weight of 292.16 g/mol. Its IUPAC name is 4-(2,3-dichlorophenoxy)-3-(dimethylamino)butanoic acid.
| Compound Name | 4-(2,3-dichlorophenoxy)-3-(dimethylamino)butanoic acid |
|---|---|
| PubChem CID | 112547485 |
| Molecular Formula | C12H15Cl2NO3 |
| Molecular Weight | 292.16 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 4-(2,3-dichlorophenoxy)-3-(dimethylamino)butanoic acid |
| SMILES | CN(C)C(COc1cccc(Cl)c1Cl)CC(=O)O |
| InChI | InChI=1S/C12H15Cl2NO3/c1-15(2)8(6-11(16)17)7-18-10-5-3-4-9(13)12(10)14/h3-5,8H,6-7H2,1-2H3,(H,16,17) |
| InChIKey | HXTFYHSUEVGZTH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.16 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |