C15H14Cl2O2 — CID 55068242
1-(2,3-dichlorophenoxy)-2-phenylpropan-2-ol (PubChem CID 55068242) has the molecular formula C15H14Cl2O2 and a molecular weight of 297.18 g/mol. Its IUPAC name is 1-(2,3-dichlorophenoxy)-2-phenylpropan-2-ol.
| Compound Name | 1-(2,3-dichlorophenoxy)-2-phenylpropan-2-ol |
|---|---|
| PubChem CID | 55068242 |
| Molecular Formula | C15H14Cl2O2 |
| Molecular Weight | 297.18 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 1-(2,3-dichlorophenoxy)-2-phenylpropan-2-ol |
| SMILES | CC(O)(COc1cccc(Cl)c1Cl)c1ccccc1 |
| InChI | InChI=1S/C15H14Cl2O2/c1-15(18,11-6-3-2-4-7-11)10-19-13-9-5-8-12(16)14(13)17/h2-9,18H,10H2,1H3 |
| InChIKey | LELFGNPCBVAEOO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.18 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |