C13H10BrFO4 — CID 65203374
4-[(4-bromo-3-fluorophenoxy)methyl]-5-methylfuran-2-carboxylic acid (PubChem CID 65203374) has the molecular formula C13H10BrFO4 and a molecular weight of 329.12 g/mol. Its IUPAC name is 4-[(4-bromo-3-fluorophenoxy)methyl]-5-methylfuran-2-carboxylic acid.
| Compound Name | 4-[(4-bromo-3-fluorophenoxy)methyl]-5-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 65203374 |
| Molecular Formula | C13H10BrFO4 |
| Molecular Weight | 329.12 g/mol |
| Exact Mass | 327.97 |
| IUPAC Name | 4-[(4-bromo-3-fluorophenoxy)methyl]-5-methylfuran-2-carboxylic acid |
| SMILES | Cc1oc(C(=O)O)cc1COc1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C13H10BrFO4/c1-7-8(4-12(19-7)13(16)17)6-18-9-2-3-10(14)11(15)5-9/h2-5H,6H2,1H3,(H,16,17) |
| InChIKey | VMVQBQIGMSJBTR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.12 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'furan_acid_A(4)', 'substructure': 'N/A'} |
|---|