C14H12Br2O5 — CID 79406595
4-[(2,5-dibromo-4-methoxyphenoxy)methyl]-5-methylfuran-2-carboxylic acid (PubChem CID 79406595) has the molecular formula C14H12Br2O5 and a molecular weight of 420.05 g/mol. Its IUPAC name is 4-[(2,5-dibromo-4-methoxyphenoxy)methyl]-5-methylfuran-2-carboxylic acid.
| Compound Name | 4-[(2,5-dibromo-4-methoxyphenoxy)methyl]-5-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 79406595 |
| Molecular Formula | C14H12Br2O5 |
| Molecular Weight | 420.05 g/mol |
| Exact Mass | 417.91 |
| IUPAC Name | 4-[(2,5-dibromo-4-methoxyphenoxy)methyl]-5-methylfuran-2-carboxylic acid |
| SMILES | COc1cc(Br)c(OCc2cc(C(=O)O)oc2C)cc1Br |
| InChI | InChI=1S/C14H12Br2O5/c1-7-8(3-13(21-7)14(17)18)6-20-12-5-9(15)11(19-2)4-10(12)16/h3-5H,6H2,1-2H3,(H,17,18) |
| InChIKey | JGSYJKQVRIINCG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.05 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'furan_acid_A(4)', 'substructure': 'N/A'} |
|---|