C14H12BrClO4 — CID 63416703
4-[(4-bromo-2-chloro-6-methylphenoxy)methyl]-5-methylfuran-2-carboxylic acid (PubChem CID 63416703) has the molecular formula C14H12BrClO4 and a molecular weight of 359.60 g/mol. Its IUPAC name is 4-[(4-bromo-2-chloro-6-methylphenoxy)methyl]-5-methylfuran-2-carboxylic acid.
| Compound Name | 4-[(4-bromo-2-chloro-6-methylphenoxy)methyl]-5-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 63416703 |
| Molecular Formula | C14H12BrClO4 |
| Molecular Weight | 359.60 g/mol |
| Exact Mass | 357.96 |
| IUPAC Name | 4-[(4-bromo-2-chloro-6-methylphenoxy)methyl]-5-methylfuran-2-carboxylic acid |
| SMILES | Cc1cc(Br)cc(Cl)c1OCc1cc(C(=O)O)oc1C |
| InChI | InChI=1S/C14H12BrClO4/c1-7-3-10(15)5-11(16)13(7)19-6-9-4-12(14(17)18)20-8(9)2/h3-5H,6H2,1-2H3,(H,17,18) |
| InChIKey | PVKCFIGMQZPQLG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.60 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'furan_acid_A(4)', 'substructure': 'N/A'} |
|---|