C12H12BrClO3 — CID 77075772
4-(4-bromo-2-chloro-6-methylphenoxy)-2-methylbut-2-enoic acid (PubChem CID 77075772) has the molecular formula C12H12BrClO3 and a molecular weight of 319.58 g/mol. Its IUPAC name is 4-(4-bromo-2-chloro-6-methylphenoxy)-2-methylbut-2-enoic acid.
| Compound Name | 4-(4-bromo-2-chloro-6-methylphenoxy)-2-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 77075772 |
| Molecular Formula | C12H12BrClO3 |
| Molecular Weight | 319.58 g/mol |
| Exact Mass | 317.97 |
| IUPAC Name | 4-(4-bromo-2-chloro-6-methylphenoxy)-2-methylbut-2-enoic acid |
| SMILES | CC(=CCOc1c(C)cc(Br)cc1Cl)C(=O)O |
| InChI | InChI=1S/C12H12BrClO3/c1-7(12(15)16)3-4-17-11-8(2)5-9(13)6-10(11)14/h3,5-6H,4H2,1-2H3,(H,15,16) |
| InChIKey | FYDPXZQVRKMUMK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.58 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|