C13H10Br2O5 — CID 79416307
2-[(2,5-dibromo-4-methoxyphenoxy)methyl]furan-3-carboxylic acid (PubChem CID 79416307) has the molecular formula C13H10Br2O5 and a molecular weight of 406.03 g/mol. Its IUPAC name is 2-[(2,5-dibromo-4-methoxyphenoxy)methyl]furan-3-carboxylic acid.
| Compound Name | 2-[(2,5-dibromo-4-methoxyphenoxy)methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 79416307 |
| Molecular Formula | C13H10Br2O5 |
| Molecular Weight | 406.03 g/mol |
| Exact Mass | 403.89 |
| IUPAC Name | 2-[(2,5-dibromo-4-methoxyphenoxy)methyl]furan-3-carboxylic acid |
| SMILES | COc1cc(Br)c(OCc2occc2C(=O)O)cc1Br |
| InChI | InChI=1S/C13H10Br2O5/c1-18-10-4-9(15)11(5-8(10)14)20-6-12-7(13(16)17)2-3-19-12/h2-5H,6H2,1H3,(H,16,17) |
| InChIKey | HTTUIMFKFMDSCT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.03 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |