C35H31IO9 — CID 158364687
4-[[4-(4-acetylphenyl)phenoxy]methyl]-5-methylfuran-2-carboxylic acid;methyl 4-[(4-iodophenoxy)methyl]-5-methylfuran-2-carboxylate (PubChem CID 158364687) has the molecular formula C35H31IO9 and a molecular weight of 722.53 g/mol. Its IUPAC name is 4-[[4-(4-acetylphenyl)phenoxy]methyl]-5-methylfuran-2-carboxylic acid;methyl 4-[(4-iodophenoxy)methyl]-5-methylfuran-2-carboxylate.
| Compound Name | 4-[[4-(4-acetylphenyl)phenoxy]methyl]-5-methylfuran-2-carboxylic acid;methyl 4-[(4-iodophenoxy)methyl]-5-methylfuran-2-carboxylate |
|---|---|
| PubChem CID | 158364687 |
| Molecular Formula | C35H31IO9 |
| Molecular Weight | 722.53 g/mol |
| Exact Mass | 722.10 |
| IUPAC Name | 4-[[4-(4-acetylphenyl)phenoxy]methyl]-5-methylfuran-2-carboxylic acid;methyl 4-[(4-iodophenoxy)methyl]-5-methylfuran-2-carboxylate |
| SMILES | CC(=O)c1ccc(-c2ccc(OCc3cc(C(=O)O)oc3C)cc2)cc1.COC(=O)c1cc(COc2ccc(I)cc2)c(C)o1 |
| InChI | InChI=1S/C21H18O5.C14H13IO4/c1-13(22)15-3-5-16(6-4-15)17-7-9-19(10-8-17)25-12-18-11-20(21(23)24)26-14(18)2;1-9-10(7-13(19-9)14(16)17-2)8-18-12-5-3-11(15)4-6-12/h3-11H,12H2,1-2H3,(H,23,24);3-7H,8H2,1-2H3 |
| InChIKey | GTWSVOQYEVRJPQ-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 125.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.53 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'furan_acid_A(4)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|