C24H32O5 — CID 142927156
ethane;4-[[4-[(3E,6E)-7-methoxyocta-3,6-dien-3-yl]phenoxy]methyl]-5-methylfuran-2-carboxylic acid (PubChem CID 142927156) has the molecular formula C24H32O5 and a molecular weight of 400.52 g/mol. Its IUPAC name is ethane;4-[[4-[(3E,6E)-7-methoxyocta-3,6-dien-3-yl]phenoxy]methyl]-5-methylfuran-2-carboxylic acid.
| Compound Name | ethane;4-[[4-[(3E,6E)-7-methoxyocta-3,6-dien-3-yl]phenoxy]methyl]-5-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 142927156 |
| Molecular Formula | C24H32O5 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | ethane;4-[[4-[(3E,6E)-7-methoxyocta-3,6-dien-3-yl]phenoxy]methyl]-5-methylfuran-2-carboxylic acid |
| SMILES | CC.CC/C(=C\C/C=C(\C)OC)c1ccc(OCc2cc(C(=O)O)oc2C)cc1 |
| InChI | InChI=1S/C22H26O5.C2H6/c1-5-17(8-6-7-15(2)25-4)18-9-11-20(12-10-18)26-14-19-13-21(22(23)24)27-16(19)3;1-2/h7-13H,5-6,14H2,1-4H3,(H,23,24);1-2H3/b15-7+,17-8+; |
| InChIKey | LJVDSNYDYANRLP-VTMOGBGJSA-N |
| XLogP | 6.63 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'furan_acid_A(4)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|