C22H23NO6S — CID 58824164
3-methoxy-N-[5-methyl-4-[(4-phenylphenoxy)methyl]furan-2-yl]sulfonylpropanamide (PubChem CID 58824164) has the molecular formula C22H23NO6S and a molecular weight of 429.49 g/mol. Its IUPAC name is 3-methoxy-N-[5-methyl-4-[(4-phenylphenoxy)methyl]furan-2-yl]sulfonylpropanamide.
| Compound Name | 3-methoxy-N-[5-methyl-4-[(4-phenylphenoxy)methyl]furan-2-yl]sulfonylpropanamide |
|---|---|
| PubChem CID | 58824164 |
| Molecular Formula | C22H23NO6S |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | 3-methoxy-N-[5-methyl-4-[(4-phenylphenoxy)methyl]furan-2-yl]sulfonylpropanamide |
| SMILES | COCCC(=O)NS(=O)(=O)c1cc(COc2ccc(-c3ccccc3)cc2)c(C)o1 |
| InChI | InChI=1S/C22H23NO6S/c1-16-19(14-22(29-16)30(25,26)23-21(24)12-13-27-2)15-28-20-10-8-18(9-11-20)17-6-4-3-5-7-17/h3-11,14H,12-13,15H2,1-2H3,(H,23,24) |
| InChIKey | PDQYLSZPYBYEJZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |