C19H15FO4 — CID 172705932
3-[[4-(4-fluorophenyl)phenoxy]methyl]-5-methylfuran-2-carboxylic acid (PubChem CID 172705932) has the molecular formula C19H15FO4 and a molecular weight of 326.32 g/mol. Its IUPAC name is 3-[[4-(4-fluorophenyl)phenoxy]methyl]-5-methylfuran-2-carboxylic acid.
| Compound Name | 3-[[4-(4-fluorophenyl)phenoxy]methyl]-5-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 172705932 |
| Molecular Formula | C19H15FO4 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 3-[[4-(4-fluorophenyl)phenoxy]methyl]-5-methylfuran-2-carboxylic acid |
| SMILES | Cc1cc(COc2ccc(-c3ccc(F)cc3)cc2)c(C(=O)O)o1 |
| InChI | InChI=1S/C19H15FO4/c1-12-10-15(18(24-12)19(21)22)11-23-17-8-4-14(5-9-17)13-2-6-16(20)7-3-13/h2-10H,11H2,1H3,(H,21,22) |
| InChIKey | DOXPMECXPIPLLW-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |