C15H12F2O3 — CID 107675308
2-fluoro-4-[(5-fluoro-2-methylphenyl)methoxy]benzoic acid (PubChem CID 107675308) has the molecular formula C15H12F2O3 and a molecular weight of 278.25 g/mol. Its IUPAC name is 2-fluoro-4-[(5-fluoro-2-methylphenyl)methoxy]benzoic acid.
| Compound Name | 2-fluoro-4-[(5-fluoro-2-methylphenyl)methoxy]benzoic acid |
|---|---|
| PubChem CID | 107675308 |
| Molecular Formula | C15H12F2O3 |
| Molecular Weight | 278.25 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 2-fluoro-4-[(5-fluoro-2-methylphenyl)methoxy]benzoic acid |
| SMILES | Cc1ccc(F)cc1COc1ccc(C(=O)O)c(F)c1 |
| InChI | InChI=1S/C15H12F2O3/c1-9-2-3-11(16)6-10(9)8-20-12-4-5-13(15(18)19)14(17)7-12/h2-7H,8H2,1H3,(H,18,19) |
| InChIKey | IOLAOKIBXDHFER-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.25 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |