C15H11Cl2FO3 — CID 118501542
5-chloro-4-[(3-chloro-4-methylphenoxy)methyl]-2-fluorobenzoic acid (PubChem CID 118501542) has the molecular formula C15H11Cl2FO3 and a molecular weight of 329.15 g/mol. Its IUPAC name is 5-chloro-4-[(3-chloro-4-methylphenoxy)methyl]-2-fluorobenzoic acid.
| Compound Name | 5-chloro-4-[(3-chloro-4-methylphenoxy)methyl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 118501542 |
| Molecular Formula | C15H11Cl2FO3 |
| Molecular Weight | 329.15 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 5-chloro-4-[(3-chloro-4-methylphenoxy)methyl]-2-fluorobenzoic acid |
| SMILES | Cc1ccc(OCc2cc(F)c(C(=O)O)cc2Cl)cc1Cl |
| InChI | InChI=1S/C15H11Cl2FO3/c1-8-2-3-10(5-12(8)16)21-7-9-4-14(18)11(15(19)20)6-13(9)17/h2-6H,7H2,1H3,(H,19,20) |
| InChIKey | ARGZYXPDSPLVKV-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.15 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |