2-(2-methoxy-4-phenylphenyl)acetic acid

C15H14O3 — CID 23503476

IUPAC2-(2-methoxy-4-phenylphenyl)acetic acid
SMILESCOc1cc(-c2ccccc2)ccc1CC(=O)O
InChIInChI=1S/C15H14O3/c1-18-14-9-12(11-5-3-2-4-6-11)7-8-13(14)10-15(16)17/h2-9H,10H2,1H3,(H,16,17)
InChIKeyRLBGWKIRJJAWPC-UHFFFAOYSA-N
MW242.27 g/mol
LogP2.99
Rot. Bonds4

About 2-(2-methoxy-4-phenylphenyl)acetic acid

2-(2-methoxy-4-phenylphenyl)acetic acid (PubChem CID 23503476) has the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. Its IUPAC name is 2-(2-methoxy-4-phenylphenyl)acetic acid.

Molecular Properties

Compound Name2-(2-methoxy-4-phenylphenyl)acetic acid
PubChem CID23503476
Molecular FormulaC15H14O3
Molecular Weight242.27 g/mol
Exact Mass242.09
IUPAC Name2-(2-methoxy-4-phenylphenyl)acetic acid
SMILESCOc1cc(-c2ccccc2)ccc1CC(=O)O
InChIInChI=1S/C15H14O3/c1-18-14-9-12(11-5-3-2-4-6-11)7-8-13(14)10-15(16)17/h2-9H,10H2,1H3,(H,16,17)
InChIKeyRLBGWKIRJJAWPC-UHFFFAOYSA-N
XLogP2.99
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.27
LogP ≤ 52.99
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(2-methoxy-4-phenylphenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(2-methoxy-4-phenylphenyl)methanesulfinic acid
CID 174562997
2-(2,5-dimethoxy-4-phenylphenyl)acetic acid
CID 4270797
2-(2-ethyl-6-methoxy-4-phenylphenyl)acetic acid
CID 66707549
methyl 2-[4-(4-chlorophenyl)-2-methoxyphenyl]acetate
CID 12732375
2-[3-(4-methoxy-3-phenylmethoxyphenyl)phenyl]acetic acid
CID 22930517
4-[(2-methoxy-4-phenylphenyl)methylamino]cyclohexane-1-carboxylic acid
CID 120509709
1-[(2-methoxy-4-phenylphenyl)methyl]pyrrolidine-2-carboxylic acid
CID 122036642
4-[(2-methoxy-4-phenylphenyl)methylamino]-2-methylbenzamide
CID 100656156
2-[2-(aminomethyl)-5-phenylphenyl]acetic acid
CID 67211965
3-[4-(2-chlorophenyl)-2-methoxyphenyl]propanoic acid
CID 166398717
1-[(2-methoxy-4-phenylphenyl)methyl]pyrrolidine-3-carboxamide
CID 75501255
N-[(2,4-dimethoxyphenyl)methyl]-4-phenylbenzamide
CID 46590205

Frequently Asked Questions

What is the IUPAC name of 2-(2-methoxy-4-phenylphenyl)acetic acid?
The IUPAC name of 2-(2-methoxy-4-phenylphenyl)acetic acid (CID 23503476) is 2-(2-methoxy-4-phenylphenyl)acetic acid.
What is the SMILES notation for 2-(2-methoxy-4-phenylphenyl)acetic acid?
The canonical SMILES for 2-(2-methoxy-4-phenylphenyl)acetic acid is COc1cc(-c2ccccc2)ccc1CC(=O)O.
What is the InChIKey of 2-(2-methoxy-4-phenylphenyl)acetic acid?
The InChIKey is RLBGWKIRJJAWPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O3/c1-18-14-9-12(11-5-3-2-4-6-11)7-8-13(14)10-15(16)17/h2-9H,10H2,1H3,(H,16,17).
What are the key properties of 2-(2-methoxy-4-phenylphenyl)acetic acid?
2-(2-methoxy-4-phenylphenyl)acetic acid has a molecular weight of 242.27 g/mol, XLogP of 2.99, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methoxy-4-phenylphenyl)acetic acid is sourced from PubChem (CID 23503476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).