2-(2,5-dimethoxy-4-phenylphenyl)acetic acid

C16H16O4 — CID 4270797

IUPAC2-(2,5-dimethoxy-4-phenylphenyl)acetic acid
SMILESCOc1cc(-c2ccccc2)c(OC)cc1CC(=O)O
InChIInChI=1S/C16H16O4/c1-19-14-10-13(11-6-4-3-5-7-11)15(20-2)8-12(14)9-16(17)18/h3-8,10H,9H2,1-2H3,(H,17,18)
InChIKeyYUDTYXKEWWPEDR-UHFFFAOYSA-N
MW272.30 g/mol
LogP3.00
Rot. Bonds5

About 2-(2,5-dimethoxy-4-phenylphenyl)acetic acid

2-(2,5-dimethoxy-4-phenylphenyl)acetic acid (PubChem CID 4270797) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is 2-(2,5-dimethoxy-4-phenylphenyl)acetic acid.

Molecular Properties

Compound Name2-(2,5-dimethoxy-4-phenylphenyl)acetic acid
PubChem CID4270797
Molecular FormulaC16H16O4
Molecular Weight272.30 g/mol
Exact Mass272.10
IUPAC Name2-(2,5-dimethoxy-4-phenylphenyl)acetic acid
SMILESCOc1cc(-c2ccccc2)c(OC)cc1CC(=O)O
InChIInChI=1S/C16H16O4/c1-19-14-10-13(11-6-4-3-5-7-11)15(20-2)8-12(14)9-16(17)18/h3-8,10H,9H2,1-2H3,(H,17,18)
InChIKeyYUDTYXKEWWPEDR-UHFFFAOYSA-N
XLogP3.00
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.30
LogP ≤ 53.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(2,5-dimethoxy-4-phenylphenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,5-dimethoxy-4-phenylphenyl)acetic acid?
The IUPAC name of 2-(2,5-dimethoxy-4-phenylphenyl)acetic acid (CID 4270797) is 2-(2,5-dimethoxy-4-phenylphenyl)acetic acid.
What is the SMILES notation for 2-(2,5-dimethoxy-4-phenylphenyl)acetic acid?
The canonical SMILES for 2-(2,5-dimethoxy-4-phenylphenyl)acetic acid is COc1cc(-c2ccccc2)c(OC)cc1CC(=O)O.
What is the InChIKey of 2-(2,5-dimethoxy-4-phenylphenyl)acetic acid?
The InChIKey is YUDTYXKEWWPEDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O4/c1-19-14-10-13(11-6-4-3-5-7-11)15(20-2)8-12(14)9-16(17)18/h3-8,10H,9H2,1-2H3,(H,17,18).
What are the key properties of 2-(2,5-dimethoxy-4-phenylphenyl)acetic acid?
2-(2,5-dimethoxy-4-phenylphenyl)acetic acid has a molecular weight of 272.30 g/mol, XLogP of 3.00, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethoxy-4-phenylphenyl)acetic acid is sourced from PubChem (CID 4270797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).