C21H19FO4S — CID 91412568
2-[[3-[[5-(4-fluorophenyl)-2-methylfuran-3-yl]methoxy]phenyl]methylsulfanyl]acetic acid (PubChem CID 91412568) has the molecular formula C21H19FO4S and a molecular weight of 386.44 g/mol. Its IUPAC name is 2-[[3-[[5-(4-fluorophenyl)-2-methylfuran-3-yl]methoxy]phenyl]methylsulfanyl]acetic acid.
| Compound Name | 2-[[3-[[5-(4-fluorophenyl)-2-methylfuran-3-yl]methoxy]phenyl]methylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 91412568 |
| Molecular Formula | C21H19FO4S |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 2-[[3-[[5-(4-fluorophenyl)-2-methylfuran-3-yl]methoxy]phenyl]methylsulfanyl]acetic acid |
| SMILES | Cc1oc(-c2ccc(F)cc2)cc1COc1cccc(CSCC(=O)O)c1 |
| InChI | InChI=1S/C21H19FO4S/c1-14-17(10-20(26-14)16-5-7-18(22)8-6-16)11-25-19-4-2-3-15(9-19)12-27-13-21(23)24/h2-10H,11-13H2,1H3,(H,23,24) |
| InChIKey | FDIGBRZIFCZRKW-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |