C24H24O3S — CID 23552042
methyl 2-[[3-[2-(4-phenylphenyl)ethoxy]phenyl]methylsulfanyl]acetate (PubChem CID 23552042) has the molecular formula C24H24O3S and a molecular weight of 392.52 g/mol. Its IUPAC name is methyl 2-[[3-[2-(4-phenylphenyl)ethoxy]phenyl]methylsulfanyl]acetate.
| Compound Name | methyl 2-[[3-[2-(4-phenylphenyl)ethoxy]phenyl]methylsulfanyl]acetate |
|---|---|
| PubChem CID | 23552042 |
| Molecular Formula | C24H24O3S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | methyl 2-[[3-[2-(4-phenylphenyl)ethoxy]phenyl]methylsulfanyl]acetate |
| SMILES | COC(=O)CSCc1cccc(OCCc2ccc(-c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C24H24O3S/c1-26-24(25)18-28-17-20-6-5-9-23(16-20)27-15-14-19-10-12-22(13-11-19)21-7-3-2-4-8-21/h2-13,16H,14-15,17-18H2,1H3 |
| InChIKey | QWYUFPYBPMYDSS-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |