C23H25NO4S — CID 58859472
methyl 2-[[3-[3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propoxy]phenyl]methylsulfanyl]acetate (PubChem CID 58859472) has the molecular formula C23H25NO4S and a molecular weight of 411.52 g/mol. Its IUPAC name is methyl 2-[[3-[3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propoxy]phenyl]methylsulfanyl]acetate.
| Compound Name | methyl 2-[[3-[3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propoxy]phenyl]methylsulfanyl]acetate |
|---|---|
| PubChem CID | 58859472 |
| Molecular Formula | C23H25NO4S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | methyl 2-[[3-[3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propoxy]phenyl]methylsulfanyl]acetate |
| SMILES | COC(=O)CSCc1cccc(OCCCc2nc(-c3ccccc3)oc2C)c1 |
| InChI | InChI=1S/C23H25NO4S/c1-17-21(24-23(28-17)19-9-4-3-5-10-19)12-7-13-27-20-11-6-8-18(14-20)15-29-16-22(25)26-2/h3-6,8-11,14H,7,12-13,15-16H2,1-2H3 |
| InChIKey | ZWZZBWMVAUZTOU-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|