C25H29NO4 — CID 23568566
methyl 6-[3-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]hexanoate (PubChem CID 23568566) has the molecular formula C25H29NO4 and a molecular weight of 407.51 g/mol. Its IUPAC name is methyl 6-[3-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]hexanoate.
| Compound Name | methyl 6-[3-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]hexanoate |
|---|---|
| PubChem CID | 23568566 |
| Molecular Formula | C25H29NO4 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | methyl 6-[3-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]hexanoate |
| SMILES | COC(=O)CCCCCc1cccc(OCCc2nc(-c3ccccc3)oc2C)c1 |
| InChI | InChI=1S/C25H29NO4/c1-19-23(26-25(30-19)21-12-6-4-7-13-21)16-17-29-22-14-9-11-20(18-22)10-5-3-8-15-24(27)28-2/h4,6-7,9,11-14,18H,3,5,8,10,15-17H2,1-2H3 |
| InChIKey | ROCGPHVYJBSQCN-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|