5-[(2,4-dibromophenoxy)methyl]-3-methylfuran-2-carboxylic acid

C13H10Br2O4 — CID 43620837

IUPAC5-[(2,4-dibromophenoxy)methyl]-3-methylfuran-2-carboxylic acid
SMILESCc1cc(COc2ccc(Br)cc2Br)oc1C(=O)O
InChIInChI=1S/C13H10Br2O4/c1-7-4-9(19-12(7)13(16)17)6-18-11-3-2-8(14)5-10(11)15/h2-5H,6H2,1H3,(H,16,17)
InChIKeyIOKWBVWFQFAFSG-UHFFFAOYSA-N
MW390.03 g/mol
LogP4.39
Rot. Bonds4

About 5-[(2,4-dibromophenoxy)methyl]-3-methylfuran-2-carboxylic acid

5-[(2,4-dibromophenoxy)methyl]-3-methylfuran-2-carboxylic acid (PubChem CID 43620837) has the molecular formula C13H10Br2O4 and a molecular weight of 390.03 g/mol. Its IUPAC name is 5-[(2,4-dibromophenoxy)methyl]-3-methylfuran-2-carboxylic acid.

Molecular Properties

Compound Name5-[(2,4-dibromophenoxy)methyl]-3-methylfuran-2-carboxylic acid
PubChem CID43620837
Molecular FormulaC13H10Br2O4
Molecular Weight390.03 g/mol
Exact Mass387.89
IUPAC Name5-[(2,4-dibromophenoxy)methyl]-3-methylfuran-2-carboxylic acid
SMILESCc1cc(COc2ccc(Br)cc2Br)oc1C(=O)O
InChIInChI=1S/C13H10Br2O4/c1-7-4-9(19-12(7)13(16)17)6-18-11-3-2-8(14)5-10(11)15/h2-5H,6H2,1H3,(H,16,17)
InChIKeyIOKWBVWFQFAFSG-UHFFFAOYSA-N
XLogP4.39
TPSA59.67 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500390.03
LogP ≤ 54.39
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-[(2,4-dibromophenoxy)methyl]-3-methylfuran-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[(2,4-dibromophenoxy)methyl]-3-methylfuran-2-carboxylic acid?
The IUPAC name of 5-[(2,4-dibromophenoxy)methyl]-3-methylfuran-2-carboxylic acid (CID 43620837) is 5-[(2,4-dibromophenoxy)methyl]-3-methylfuran-2-carboxylic acid.
What is the SMILES notation for 5-[(2,4-dibromophenoxy)methyl]-3-methylfuran-2-carboxylic acid?
The canonical SMILES for 5-[(2,4-dibromophenoxy)methyl]-3-methylfuran-2-carboxylic acid is Cc1cc(COc2ccc(Br)cc2Br)oc1C(=O)O.
What is the InChIKey of 5-[(2,4-dibromophenoxy)methyl]-3-methylfuran-2-carboxylic acid?
The InChIKey is IOKWBVWFQFAFSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10Br2O4/c1-7-4-9(19-12(7)13(16)17)6-18-11-3-2-8(14)5-10(11)15/h2-5H,6H2,1H3,(H,16,17).
What are the key properties of 5-[(2,4-dibromophenoxy)methyl]-3-methylfuran-2-carboxylic acid?
5-[(2,4-dibromophenoxy)methyl]-3-methylfuran-2-carboxylic acid has a molecular weight of 390.03 g/mol, XLogP of 4.39, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,4-dibromophenoxy)methyl]-3-methylfuran-2-carboxylic acid is sourced from PubChem (CID 43620837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).