C14H12O5 — CID 43620851
5-[(4-formylphenoxy)methyl]-3-methylfuran-2-carboxylic acid (PubChem CID 43620851) has the molecular formula C14H12O5 and a molecular weight of 260.25 g/mol. Its IUPAC name is 5-[(4-formylphenoxy)methyl]-3-methylfuran-2-carboxylic acid.
| Compound Name | 5-[(4-formylphenoxy)methyl]-3-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 43620851 |
| Molecular Formula | C14H12O5 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 5-[(4-formylphenoxy)methyl]-3-methylfuran-2-carboxylic acid |
| SMILES | Cc1cc(COc2ccc(C=O)cc2)oc1C(=O)O |
| InChI | InChI=1S/C14H12O5/c1-9-6-12(19-13(9)14(16)17)8-18-11-4-2-10(7-15)3-5-11/h2-7H,8H2,1H3,(H,16,17) |
| InChIKey | NBILDENICBXFLK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|