C14H13FN2O4 — CID 107693729
5-[(2-fluoro-4-formylphenoxy)methyl]-3-methylfuran-2-carbohydrazide (PubChem CID 107693729) has the molecular formula C14H13FN2O4 and a molecular weight of 292.27 g/mol. Its IUPAC name is 5-[(2-fluoro-4-formylphenoxy)methyl]-3-methylfuran-2-carbohydrazide.
| Compound Name | 5-[(2-fluoro-4-formylphenoxy)methyl]-3-methylfuran-2-carbohydrazide |
|---|---|
| PubChem CID | 107693729 |
| Molecular Formula | C14H13FN2O4 |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 5-[(2-fluoro-4-formylphenoxy)methyl]-3-methylfuran-2-carbohydrazide |
| SMILES | Cc1cc(COc2ccc(C=O)cc2F)oc1C(=O)NN |
| InChI | InChI=1S/C14H13FN2O4/c1-8-4-10(21-13(8)14(19)17-16)7-20-12-3-2-9(6-18)5-11(12)15/h2-6H,7,16H2,1H3,(H,17,19) |
| InChIKey | PAQSGHCGPKWYKU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|