C13H12BrFN2O3 — CID 83234267
5-[(3-bromo-4-fluorophenoxy)methyl]-3-methylfuran-2-carbohydrazide (PubChem CID 83234267) has the molecular formula C13H12BrFN2O3 and a molecular weight of 343.15 g/mol. Its IUPAC name is 5-[(3-bromo-4-fluorophenoxy)methyl]-3-methylfuran-2-carbohydrazide.
| Compound Name | 5-[(3-bromo-4-fluorophenoxy)methyl]-3-methylfuran-2-carbohydrazide |
|---|---|
| PubChem CID | 83234267 |
| Molecular Formula | C13H12BrFN2O3 |
| Molecular Weight | 343.15 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 5-[(3-bromo-4-fluorophenoxy)methyl]-3-methylfuran-2-carbohydrazide |
| SMILES | Cc1cc(COc2ccc(F)c(Br)c2)oc1C(=O)NN |
| InChI | InChI=1S/C13H12BrFN2O3/c1-7-4-9(20-12(7)13(18)17-16)6-19-8-2-3-11(15)10(14)5-8/h2-5H,6,16H2,1H3,(H,17,18) |
| InChIKey | UPYGWALNMSAUBP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.15 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|