C13H8F4O4 — CID 103288809
3-methyl-5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-carboxylic acid (PubChem CID 103288809) has the molecular formula C13H8F4O4 and a molecular weight of 304.19 g/mol. Its IUPAC name is 3-methyl-5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-carboxylic acid.
| Compound Name | 3-methyl-5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 103288809 |
| Molecular Formula | C13H8F4O4 |
| Molecular Weight | 304.19 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 3-methyl-5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-carboxylic acid |
| SMILES | Cc1cc(COc2c(F)c(F)cc(F)c2F)oc1C(=O)O |
| InChI | InChI=1S/C13H8F4O4/c1-5-2-6(21-11(5)13(18)19)4-20-12-9(16)7(14)3-8(15)10(12)17/h2-3H,4H2,1H3,(H,18,19) |
| InChIKey | CGZJMHPUDJEHIQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.19 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|