C21H26O4 — CID 135737641
(2Z,5S,11R,12R)-12-methoxy-3,14-dimethyl-11-prop-1-en-2-yl-6,16-dioxatricyclo[11.2.1.15,8]heptadeca-1(15),2,8(17),13-tetraen-7-one (PubChem CID 135737641) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is (2Z,5S,11R,12R)-12-methoxy-3,14-dimethyl-11-prop-1-en-2-yl-6,16-dioxatricyclo[11.2.1.15,8]heptadeca-1(15),2,8(17),13-tetraen-7-one.
| Compound Name | (2Z,5S,11R,12R)-12-methoxy-3,14-dimethyl-11-prop-1-en-2-yl-6,16-dioxatricyclo[11.2.1.15,8]heptadeca-1(15),2,8(17),13-tetraen-7-one |
|---|---|
| PubChem CID | 135737641 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | (2Z,5S,11R,12R)-12-methoxy-3,14-dimethyl-11-prop-1-en-2-yl-6,16-dioxatricyclo[11.2.1.15,8]heptadeca-1(15),2,8(17),13-tetraen-7-one |
| SMILES | C=C(C)[C@H]1CCC2=C[C@H](C/C(C)=C\c3cc(C)c(o3)[C@@H]1OC)OC2=O |
| InChI | InChI=1S/C21H26O4/c1-12(2)18-7-6-15-11-17(25-21(15)22)9-13(3)8-16-10-14(4)19(24-16)20(18)23-5/h8,10-11,17-18,20H,1,6-7,9H2,2-5H3/b13-8-/t17-,18+,20+/m0/s1 |
| InChIKey | ODVCRTZCBFWAOL-MEBDZDATSA-N |
| XLogP | 4.91 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|