C20H26O6 — CID 10832484
(1R,5S,7Z,11S,12R,13S,14S)-12,13-dihydroxy-7,11-dimethyl-14-prop-1-en-2-yl-4,16-dioxatricyclo[10.3.1.12,5]heptadeca-2(17),7-diene-3,9-dione (PubChem CID 10832484) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is (1R,5S,7Z,11S,12R,13S,14S)-12,13-dihydroxy-7,11-dimethyl-14-prop-1-en-2-yl-4,16-dioxatricyclo[10.3.1.12,5]heptadeca-2(17),7-diene-3,9-dione.
| Compound Name | (1R,5S,7Z,11S,12R,13S,14S)-12,13-dihydroxy-7,11-dimethyl-14-prop-1-en-2-yl-4,16-dioxatricyclo[10.3.1.12,5]heptadeca-2(17),7-diene-3,9-dione |
|---|---|
| PubChem CID | 10832484 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (1R,5S,7Z,11S,12R,13S,14S)-12,13-dihydroxy-7,11-dimethyl-14-prop-1-en-2-yl-4,16-dioxatricyclo[10.3.1.12,5]heptadeca-2(17),7-diene-3,9-dione |
| SMILES | C=C(C)[C@@H]1C[C@H]2O[C@](O)([C@@H](C)CC(=O)/C=C(/C)C[C@H]3C=C2C(=O)O3)[C@H]1O |
| InChI | InChI=1S/C20H26O6/c1-10(2)15-9-17-16-8-14(25-19(16)23)6-11(3)5-13(21)7-12(4)20(24,26-17)18(15)22/h5,8,12,14-15,17-18,22,24H,1,6-7,9H2,2-4H3/b11-5-/t12-,14-,15-,17+,18-,20+/m0/s1 |
| InChIKey | RLSAJLXIRCIICU-LVSFEKPUSA-N |
| XLogP | 1.81 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|