C20H26O5 — CID 162920199
(4R,7Z,11R,13S)-11-hydroxy-7,11-dimethyl-4-prop-1-en-2-yl-14-oxabicyclo[11.2.1]hexadeca-1(16),7-diene-6,9,15-trione (PubChem CID 162920199) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is (4R,7Z,11R,13S)-11-hydroxy-7,11-dimethyl-4-prop-1-en-2-yl-14-oxabicyclo[11.2.1]hexadeca-1(16),7-diene-6,9,15-trione.
| Compound Name | (4R,7Z,11R,13S)-11-hydroxy-7,11-dimethyl-4-prop-1-en-2-yl-14-oxabicyclo[11.2.1]hexadeca-1(16),7-diene-6,9,15-trione |
|---|---|
| PubChem CID | 162920199 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | (4R,7Z,11R,13S)-11-hydroxy-7,11-dimethyl-4-prop-1-en-2-yl-14-oxabicyclo[11.2.1]hexadeca-1(16),7-diene-6,9,15-trione |
| SMILES | C=C(C)[C@@H]1CCC2=C[C@H](C[C@@](C)(O)CC(=O)/C=C(/C)C(=O)C1)OC2=O |
| InChI | InChI=1S/C20H26O5/c1-12(2)14-5-6-15-8-17(25-19(15)23)11-20(4,24)10-16(21)7-13(3)18(22)9-14/h7-8,14,17,24H,1,5-6,9-11H2,2-4H3/b13-7-/t14-,17-,20+/m1/s1 |
| InChIKey | KTZVYYUYMCPVAV-ZNRNYIKGSA-N |
| XLogP | 2.83 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|