C10H14CoNiO — CID 87784204
cobalt;2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one;nickel (PubChem CID 87784204) has the molecular formula C10H14CoNiO and a molecular weight of 267.85 g/mol. Its IUPAC name is cobalt;2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one;nickel.
| Compound Name | cobalt;2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one;nickel |
|---|---|
| PubChem CID | 87784204 |
| Molecular Formula | C10H14CoNiO |
| Molecular Weight | 267.85 g/mol |
| Exact Mass | 266.97 |
| IUPAC Name | cobalt;2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one;nickel |
| SMILES | C=C(C)C1CC=C(C)C(=O)C1.[Co].[Ni] |
| InChI | InChI=1S/C10H14O.Co.Ni/c1-7(2)9-5-4-8(3)10(11)6-9;;/h4,9H,1,5-6H2,2-3H3;; |
| InChIKey | FYRDAJUXMXUPQY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.85 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|