C10H15NO — CID 139655338
5-[(E)-1-aminoprop-1-en-2-yl]-2-methylcyclohex-2-en-1-one (PubChem CID 139655338) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 5-[(E)-1-aminoprop-1-en-2-yl]-2-methylcyclohex-2-en-1-one.
| Compound Name | 5-[(E)-1-aminoprop-1-en-2-yl]-2-methylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 139655338 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 5-[(E)-1-aminoprop-1-en-2-yl]-2-methylcyclohex-2-en-1-one |
| SMILES | CC1=CCC(/C(C)=C/N)CC1=O |
| InChI | InChI=1S/C10H15NO/c1-7-3-4-9(5-10(7)12)8(2)6-11/h3,6,9H,4-5,11H2,1-2H3/b8-6+ |
| InChIKey | QPXVBAQHZRSSDK-SOFGYWHQSA-N |
| XLogP | 1.77 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |