C25H28O11 — CID 74333657
methyl 2-(10,13-diacetyloxy-3,8-dimethyl-6,9,15-trioxo-4,16-dioxatricyclo[12.2.1.03,5]heptadeca-7,14(17)-dien-11-yl)prop-2-enoate (PubChem CID 74333657) has the molecular formula C25H28O11 and a molecular weight of 504.49 g/mol. Its IUPAC name is methyl 2-(10,13-diacetyloxy-3,8-dimethyl-6,9,15-trioxo-4,16-dioxatricyclo[12.2.1.03,5]heptadeca-7,14(17)-dien-11-yl)prop-2-enoate.
| Compound Name | methyl 2-(10,13-diacetyloxy-3,8-dimethyl-6,9,15-trioxo-4,16-dioxatricyclo[12.2.1.03,5]heptadeca-7,14(17)-dien-11-yl)prop-2-enoate |
|---|---|
| PubChem CID | 74333657 |
| Molecular Formula | C25H28O11 |
| Molecular Weight | 504.49 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | methyl 2-(10,13-diacetyloxy-3,8-dimethyl-6,9,15-trioxo-4,16-dioxatricyclo[12.2.1.03,5]heptadeca-7,14(17)-dien-11-yl)prop-2-enoate |
| SMILES | C=C(C(=O)OC)C1CC(OC(C)=O)C2=CC(CC3(C)OC3C(=O)C=C(C)C(=O)C1OC(C)=O)OC2=O |
| InChI | InChI=1S/C25H28O11/c1-11-7-18(28)22-25(5,36-22)10-15-8-17(24(31)35-15)19(33-13(3)26)9-16(12(2)23(30)32-6)21(20(11)29)34-14(4)27/h7-8,15-16,19,21-22H,2,9-10H2,1,3-6H3 |
| InChIKey | RNDAYVNSDZTQEQ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 151.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.49 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|