C24H30O9 — CID 177427754
[(9Z)-8-acetyloxy-4,9-dimethyl-14-methylidene-13-oxo-5,12-dioxatricyclo[9.3.0.04,6]tetradec-9-en-2-yl] (E)-2-(acetyloxymethyl)but-2-enoate (PubChem CID 177427754) has the molecular formula C24H30O9 and a molecular weight of 462.50 g/mol. Its IUPAC name is [(9Z)-8-acetyloxy-4,9-dimethyl-14-methylidene-13-oxo-5,12-dioxatricyclo[9.3.0.04,6]tetradec-9-en-2-yl] (E)-2-(acetyloxymethyl)but-2-enoate.
| Compound Name | [(9Z)-8-acetyloxy-4,9-dimethyl-14-methylidene-13-oxo-5,12-dioxatricyclo[9.3.0.04,6]tetradec-9-en-2-yl] (E)-2-(acetyloxymethyl)but-2-enoate |
|---|---|
| PubChem CID | 177427754 |
| Molecular Formula | C24H30O9 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | [(9Z)-8-acetyloxy-4,9-dimethyl-14-methylidene-13-oxo-5,12-dioxatricyclo[9.3.0.04,6]tetradec-9-en-2-yl] (E)-2-(acetyloxymethyl)but-2-enoate |
| SMILES | C=C1C(=O)OC2/C=C(/C)C(OC(C)=O)CC3OC3(C)CC(OC(=O)/C(=C/C)COC(C)=O)C12 |
| InChI | InChI=1S/C24H30O9/c1-7-16(11-29-14(4)25)23(28)32-19-10-24(6)20(33-24)9-17(30-15(5)26)12(2)8-18-21(19)13(3)22(27)31-18/h7-8,17-21H,3,9-11H2,1-2,4-6H3/b12-8-,16-7+ |
| InChIKey | PIORCRGXNVGWFY-COAJZOOHSA-N |
| XLogP | 2.33 |
| TPSA | 117.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|