C22H28O8 — CID 162900111
(8-acetyloxy-4,9-dimethyl-14-methylidene-13-oxo-5,12-dioxatricyclo[9.3.0.04,6]tetradec-9-en-2-yl) 4-hydroxy-2-methylbut-2-enoate (PubChem CID 162900111) has the molecular formula C22H28O8 and a molecular weight of 420.46 g/mol. Its IUPAC name is (8-acetyloxy-4,9-dimethyl-14-methylidene-13-oxo-5,12-dioxatricyclo[9.3.0.04,6]tetradec-9-en-2-yl) 4-hydroxy-2-methylbut-2-enoate.
| Compound Name | (8-acetyloxy-4,9-dimethyl-14-methylidene-13-oxo-5,12-dioxatricyclo[9.3.0.04,6]tetradec-9-en-2-yl) 4-hydroxy-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162900111 |
| Molecular Formula | C22H28O8 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | (8-acetyloxy-4,9-dimethyl-14-methylidene-13-oxo-5,12-dioxatricyclo[9.3.0.04,6]tetradec-9-en-2-yl) 4-hydroxy-2-methylbut-2-enoate |
| SMILES | C=C1C(=O)OC2C=C(C)C(OC(C)=O)CC3OC3(C)CC(OC(=O)C(C)=CCO)C12 |
| InChI | InChI=1S/C22H28O8/c1-11(6-7-23)20(25)29-17-10-22(5)18(30-22)9-15(27-14(4)24)12(2)8-16-19(17)13(3)21(26)28-16/h6,8,15-19,23H,3,7,9-10H2,1-2,4-5H3 |
| InChIKey | BYUKSWNOQHMDGX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|