C22H30O7 — CID 162890733
(8-acetyloxy-4,9-dimethyl-14-methylidene-13-oxo-5,12-dioxatricyclo[9.3.0.04,6]tetradec-9-en-2-yl) 3-methylbutanoate (PubChem CID 162890733) has the molecular formula C22H30O7 and a molecular weight of 406.48 g/mol. Its IUPAC name is (8-acetyloxy-4,9-dimethyl-14-methylidene-13-oxo-5,12-dioxatricyclo[9.3.0.04,6]tetradec-9-en-2-yl) 3-methylbutanoate.
| Compound Name | (8-acetyloxy-4,9-dimethyl-14-methylidene-13-oxo-5,12-dioxatricyclo[9.3.0.04,6]tetradec-9-en-2-yl) 3-methylbutanoate |
|---|---|
| PubChem CID | 162890733 |
| Molecular Formula | C22H30O7 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | (8-acetyloxy-4,9-dimethyl-14-methylidene-13-oxo-5,12-dioxatricyclo[9.3.0.04,6]tetradec-9-en-2-yl) 3-methylbutanoate |
| SMILES | C=C1C(=O)OC2C=C(C)C(OC(C)=O)CC3OC3(C)CC(OC(=O)CC(C)C)C12 |
| InChI | InChI=1S/C22H30O7/c1-11(2)7-19(24)27-17-10-22(6)18(29-22)9-15(26-14(5)23)12(3)8-16-20(17)13(4)21(25)28-16/h8,11,15-18,20H,4,7,9-10H2,1-3,5-6H3 |
| InChIKey | AKZMBISSIWLBIT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 91.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|