C23H28O4 — CID 24939567
tert-butyl (2E,10S)-3-methyl-5-oxo-10-prop-1-en-2-yl-15-oxabicyclo[10.2.1]pentadeca-1(14),2,12-trien-6-yne-13-carboxylate (PubChem CID 24939567) has the molecular formula C23H28O4 and a molecular weight of 368.47 g/mol. Its IUPAC name is tert-butyl (2E,10S)-3-methyl-5-oxo-10-prop-1-en-2-yl-15-oxabicyclo[10.2.1]pentadeca-1(14),2,12-trien-6-yne-13-carboxylate.
| Compound Name | tert-butyl (2E,10S)-3-methyl-5-oxo-10-prop-1-en-2-yl-15-oxabicyclo[10.2.1]pentadeca-1(14),2,12-trien-6-yne-13-carboxylate |
|---|---|
| PubChem CID | 24939567 |
| Molecular Formula | C23H28O4 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | tert-butyl (2E,10S)-3-methyl-5-oxo-10-prop-1-en-2-yl-15-oxabicyclo[10.2.1]pentadeca-1(14),2,12-trien-6-yne-13-carboxylate |
| SMILES | C=C(C)[C@H]1CCC#CC(=O)C/C(C)=C/c2cc(C(=O)OC(C)(C)C)c(o2)C1 |
| InChI | InChI=1S/C23H28O4/c1-15(2)17-9-7-8-10-18(24)11-16(3)12-19-14-20(21(13-17)26-19)22(25)27-23(4,5)6/h12,14,17H,1,7,9,11,13H2,2-6H3/b16-12+/t17-/m0/s1 |
| InChIKey | JOWHFCXVMLXLHM-MOKGIYGOSA-N |
| XLogP | 5.13 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|