C23H30O4 — CID 10571207
tert-butyl (2Z)-5-hydroxy-3-methyl-10-prop-1-en-2-yl-15-oxabicyclo[10.2.1]pentadeca-1(14),2,12-trien-6-yne-13-carboxylate (PubChem CID 10571207) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is tert-butyl (2Z)-5-hydroxy-3-methyl-10-prop-1-en-2-yl-15-oxabicyclo[10.2.1]pentadeca-1(14),2,12-trien-6-yne-13-carboxylate.
| Compound Name | tert-butyl (2Z)-5-hydroxy-3-methyl-10-prop-1-en-2-yl-15-oxabicyclo[10.2.1]pentadeca-1(14),2,12-trien-6-yne-13-carboxylate |
|---|---|
| PubChem CID | 10571207 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | tert-butyl (2Z)-5-hydroxy-3-methyl-10-prop-1-en-2-yl-15-oxabicyclo[10.2.1]pentadeca-1(14),2,12-trien-6-yne-13-carboxylate |
| SMILES | C=C(C)C1CCC#CC(O)C/C(C)=C/c2cc(C(=O)OC(C)(C)C)c(o2)C1 |
| InChI | InChI=1S/C23H30O4/c1-15(2)17-9-7-8-10-18(24)11-16(3)12-19-14-20(21(13-17)26-19)22(25)27-23(4,5)6/h12,14,17-18,24H,1,7,9,11,13H2,2-6H3/b16-12+ |
| InChIKey | USBRBGARAYCZES-FOWTUZBSSA-N |
| XLogP | 4.92 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|