C22H28O6 — CID 135845083
[(2E,5S,9R,11R)-14-(hydroxymethyl)-3-methyl-7-oxo-11-prop-1-en-2-yl-6,16-dioxatricyclo[11.2.1.15,8]heptadeca-1(15),2,13-trien-9-yl] acetate (PubChem CID 135845083) has the molecular formula C22H28O6 and a molecular weight of 388.46 g/mol. Its IUPAC name is [(2E,5S,9R,11R)-14-(hydroxymethyl)-3-methyl-7-oxo-11-prop-1-en-2-yl-6,16-dioxatricyclo[11.2.1.15,8]heptadeca-1(15),2,13-trien-9-yl] acetate.
| Compound Name | [(2E,5S,9R,11R)-14-(hydroxymethyl)-3-methyl-7-oxo-11-prop-1-en-2-yl-6,16-dioxatricyclo[11.2.1.15,8]heptadeca-1(15),2,13-trien-9-yl] acetate |
|---|---|
| PubChem CID | 135845083 |
| Molecular Formula | C22H28O6 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | [(2E,5S,9R,11R)-14-(hydroxymethyl)-3-methyl-7-oxo-11-prop-1-en-2-yl-6,16-dioxatricyclo[11.2.1.15,8]heptadeca-1(15),2,13-trien-9-yl] acetate |
| SMILES | C=C(C)[C@H]1Cc2oc(cc2CO)/C=C(\C)C[C@@H]2CC(C(=O)O2)[C@H](OC(C)=O)C1 |
| InChI | InChI=1S/C22H28O6/c1-12(2)15-8-20-16(11-23)7-17(27-20)5-13(3)6-18-10-19(22(25)28-18)21(9-15)26-14(4)24/h5,7,15,18-19,21,23H,1,6,8-11H2,2-4H3/b13-5+/t15-,18+,19?,21+/m0/s1 |
| InChIKey | SINBUGNGPWTZJF-TWCZNJGHSA-N |
| XLogP | 3.57 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|